C8H20N2O8P2 — CID 87462586
(2S)-5-amino-2-[bis(phosphonomethyl)amino]-2-methylpentanoic acid (PubChem CID 87462586) has the molecular formula C8H20N2O8P2 and a molecular weight of 334.20 g/mol. Its IUPAC name is (2S)-5-amino-2-[bis(phosphonomethyl)amino]-2-methylpentanoic acid.
| Compound Name | (2S)-5-amino-2-[bis(phosphonomethyl)amino]-2-methylpentanoic acid |
|---|---|
| PubChem CID | 87462586 |
| Molecular Formula | C8H20N2O8P2 |
| Molecular Weight | 334.20 g/mol |
| Exact Mass | 334.07 |
| IUPAC Name | (2S)-5-amino-2-[bis(phosphonomethyl)amino]-2-methylpentanoic acid |
| SMILES | C[C@](CCCN)(C(=O)O)N(CP(=O)(O)O)CP(=O)(O)O |
| InChI | InChI=1S/C8H20N2O8P2/c1-8(7(11)12,3-2-4-9)10(5-19(13,14)15)6-20(16,17)18/h2-6,9H2,1H3,(H,11,12)(H2,13,14,15)(H2,16,17,18)/t8-/m0/s1 |
| InChIKey | OBEVNHQFJQTXDN-QMMMGPOBSA-N |
| XLogP | -0.86 |
| TPSA | 181.62 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.20 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|