C7H15NO11P2 — CID 74953564
2-[bis(phosphonomethyl)amino]-2-hydroxypentanedioic acid (PubChem CID 74953564) has the molecular formula C7H15NO11P2 and a molecular weight of 351.14 g/mol. Its IUPAC name is 2-[bis(phosphonomethyl)amino]-2-hydroxypentanedioic acid.
| Compound Name | 2-[bis(phosphonomethyl)amino]-2-hydroxypentanedioic acid |
|---|---|
| PubChem CID | 74953564 |
| Molecular Formula | C7H15NO11P2 |
| Molecular Weight | 351.14 g/mol |
| Exact Mass | 351.01 |
| IUPAC Name | 2-[bis(phosphonomethyl)amino]-2-hydroxypentanedioic acid |
| SMILES | O=C(O)CCC(O)(C(=O)O)N(CP(=O)(O)O)CP(=O)(O)O |
| InChI | InChI=1S/C7H15NO11P2/c9-5(10)1-2-7(13,6(11)12)8(3-20(14,15)16)4-21(17,18)19/h13H,1-4H2,(H,9,10)(H,11,12)(H2,14,15,16)(H2,17,18,19) |
| InChIKey | SPWNMYPLXTXTRW-UHFFFAOYSA-N |
| XLogP | -1.80 |
| TPSA | 213.13 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.14 |
| LogP ≤ 5 | -1.80 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|