2-[bis(phosphonomethyl)amino]-2-hydroxypentanedioic acid

C7H15NO11P2 — CID 74953564

IUPAC2-[bis(phosphonomethyl)amino]-2-hydroxypentanedioic acid
SMILESO=C(O)CCC(O)(C(=O)O)N(CP(=O)(O)O)CP(=O)(O)O
InChIInChI=1S/C7H15NO11P2/c9-5(10)1-2-7(13,6(11)12)8(3-20(14,15)16)4-21(17,18)19/h13H,1-4H2,(H,9,10)(H,11,12)(H2,14,15,16)(H2,17,18,19)
InChIKeySPWNMYPLXTXTRW-UHFFFAOYSA-N
MW351.14 g/mol
LogP-1.80
Rot. Bonds9

About 2-[bis(phosphonomethyl)amino]-2-hydroxypentanedioic acid

2-[bis(phosphonomethyl)amino]-2-hydroxypentanedioic acid (PubChem CID 74953564) has the molecular formula C7H15NO11P2 and a molecular weight of 351.14 g/mol. Its IUPAC name is 2-[bis(phosphonomethyl)amino]-2-hydroxypentanedioic acid.

Molecular Properties

Compound Name2-[bis(phosphonomethyl)amino]-2-hydroxypentanedioic acid
PubChem CID74953564
Molecular FormulaC7H15NO11P2
Molecular Weight351.14 g/mol
Exact Mass351.01
IUPAC Name2-[bis(phosphonomethyl)amino]-2-hydroxypentanedioic acid
SMILESO=C(O)CCC(O)(C(=O)O)N(CP(=O)(O)O)CP(=O)(O)O
InChIInChI=1S/C7H15NO11P2/c9-5(10)1-2-7(13,6(11)12)8(3-20(14,15)16)4-21(17,18)19/h13H,1-4H2,(H,9,10)(H,11,12)(H2,14,15,16)(H2,17,18,19)
InChIKeySPWNMYPLXTXTRW-UHFFFAOYSA-N
XLogP-1.80
TPSA213.13 Ų
H-Bond Donors7
H-Bond Acceptors6
Rotatable Bonds9
Heavy Atoms21
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500351.14
LogP ≤ 5-1.80
H-Bond Donors ≤ 57
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze 2-[bis(phosphonomethyl)amino]-2-hydroxypentanedioic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[bis(phosphonomethyl)amino]-2-hydroxypentanedioic acid?
The IUPAC name of 2-[bis(phosphonomethyl)amino]-2-hydroxypentanedioic acid (CID 74953564) is 2-[bis(phosphonomethyl)amino]-2-hydroxypentanedioic acid.
What is the SMILES notation for 2-[bis(phosphonomethyl)amino]-2-hydroxypentanedioic acid?
The canonical SMILES for 2-[bis(phosphonomethyl)amino]-2-hydroxypentanedioic acid is O=C(O)CCC(O)(C(=O)O)N(CP(=O)(O)O)CP(=O)(O)O.
What is the InChIKey of 2-[bis(phosphonomethyl)amino]-2-hydroxypentanedioic acid?
The InChIKey is SPWNMYPLXTXTRW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15NO11P2/c9-5(10)1-2-7(13,6(11)12)8(3-20(14,15)16)4-21(17,18)19/h13H,1-4H2,(H,9,10)(H,11,12)(H2,14,15,16)(H2,17,18,19).
What are the key properties of 2-[bis(phosphonomethyl)amino]-2-hydroxypentanedioic acid?
2-[bis(phosphonomethyl)amino]-2-hydroxypentanedioic acid has a molecular weight of 351.14 g/mol, XLogP of -1.80, 9 rotatable bonds, 7 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[bis(phosphonomethyl)amino]-2-hydroxypentanedioic acid is sourced from PubChem (CID 74953564), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).