C5H15NO14P4 — CID 23451923
3-[bis(diphosphonomethyl)amino]propanoic acid (PubChem CID 23451923) has the molecular formula C5H15NO14P4 and a molecular weight of 437.06 g/mol. Its IUPAC name is 3-[bis(diphosphonomethyl)amino]propanoic acid.
| Compound Name | 3-[bis(diphosphonomethyl)amino]propanoic acid |
|---|---|
| PubChem CID | 23451923 |
| Molecular Formula | C5H15NO14P4 |
| Molecular Weight | 437.06 g/mol |
| Exact Mass | 436.94 |
| IUPAC Name | 3-[bis(diphosphonomethyl)amino]propanoic acid |
| SMILES | O=C(O)CCN(C(P(=O)(O)O)P(=O)(O)O)C(P(=O)(O)O)P(=O)(O)O |
| InChI | InChI=1S/C5H15NO14P4/c7-3(8)1-2-6(4(21(9,10)11)22(12,13)14)5(23(15,16)17)24(18,19)20/h4-5H,1-2H2,(H,7,8)(H2,9,10,11)(H2,12,13,14)(H2,15,16,17)(H2,18,19,20) |
| InChIKey | AMSWVVOJUYOSOZ-UHFFFAOYSA-N |
| XLogP | -1.96 |
| TPSA | 270.66 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.06 |
| LogP ≤ 5 | -1.96 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|