C13H37N3O26P8 — CID 88894629
(2S)-2-[bis[3-[bis(diphosphonomethyl)amino]propyl]amino]propanoic acid (PubChem CID 88894629) has the molecular formula C13H37N3O26P8 and a molecular weight of 899.23 g/mol. Its IUPAC name is (2S)-2-[bis[3-[bis(diphosphonomethyl)amino]propyl]amino]propanoic acid.
| Compound Name | (2S)-2-[bis[3-[bis(diphosphonomethyl)amino]propyl]amino]propanoic acid |
|---|---|
| PubChem CID | 88894629 |
| Molecular Formula | C13H37N3O26P8 |
| Molecular Weight | 899.23 g/mol |
| Exact Mass | 898.96 |
| IUPAC Name | (2S)-2-[bis[3-[bis(diphosphonomethyl)amino]propyl]amino]propanoic acid |
| SMILES | C[C@@H](C(=O)O)N(CCCN(C(P(=O)(O)O)P(=O)(O)O)C(P(=O)(O)O)P(=O)(O)O)CCCN(C(P(=O)(O)O)P(=O)(O)O)C(P(=O)(O)O)P(=O)(O)O |
| InChI | InChI=1S/C13H37N3O26P8/c1-8(9(17)18)14(4-2-6-15(10(43(19,20)21)44(22,23)24)11(45(25,26)27)46(28,29)30)5-3-7-16(12(47(31,32)33)48(34,35)36)13(49(37,38)39)50(40,41)42/h8,10-13H,2-7H2,1H3,(H,17,18)(H2,19,20,21)(H2,22,23,24)(H2,25,26,27)(H2,28,29,30)(H2,31,32,33)(H2,34,35,36)(H2,37,38,39)(H2,40,41,42)/t8-/m0/s1 |
| InChIKey | LYHWQLMDTYYNCR-QMMMGPOBSA-N |
| XLogP | -3.30 |
| TPSA | 507.26 Ų |
| H-Bond Donors | 17 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 899.23 |
| LogP ≤ 5 | -3.30 |
| H-Bond Donors ≤ 5 | 17 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|