C6H17ClNO6P — CID 88693647
2-(diethylamino)-2-phosphonoacetic acid;hydrate;hydrochloride (PubChem CID 88693647) has the molecular formula C6H17ClNO6P and a molecular weight of 265.63 g/mol. Its IUPAC name is 2-(diethylamino)-2-phosphonoacetic acid;hydrate;hydrochloride.
| Compound Name | 2-(diethylamino)-2-phosphonoacetic acid;hydrate;hydrochloride |
|---|---|
| PubChem CID | 88693647 |
| Molecular Formula | C6H17ClNO6P |
| Molecular Weight | 265.63 g/mol |
| Exact Mass | 265.05 |
| IUPAC Name | 2-(diethylamino)-2-phosphonoacetic acid;hydrate;hydrochloride |
| SMILES | CCN(CC)C(C(=O)O)P(=O)(O)O.Cl.O |
| InChI | InChI=1S/C6H14NO5P.ClH.H2O/c1-3-7(4-2)5(6(8)9)13(10,11)12;;/h5H,3-4H2,1-2H3,(H,8,9)(H2,10,11,12);1H;1H2 |
| InChIKey | HAJHESIXMRZLJD-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 129.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.63 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|