C20H45NO12P4 — CID 88718653
[[diphosphonomethyl-[(Z)-octadec-9-enyl]amino]-phosphonomethyl]phosphonic acid (PubChem CID 88718653) has the molecular formula C20H45NO12P4 and a molecular weight of 615.47 g/mol. Its IUPAC name is [[diphosphonomethyl-[(Z)-octadec-9-enyl]amino]-phosphonomethyl]phosphonic acid.
| Compound Name | [[diphosphonomethyl-[(Z)-octadec-9-enyl]amino]-phosphonomethyl]phosphonic acid |
|---|---|
| PubChem CID | 88718653 |
| Molecular Formula | C20H45NO12P4 |
| Molecular Weight | 615.47 g/mol |
| Exact Mass | 615.19 |
| IUPAC Name | [[diphosphonomethyl-[(Z)-octadec-9-enyl]amino]-phosphonomethyl]phosphonic acid |
| SMILES | CCCCCCCC/C=C\CCCCCCCCN(C(P(=O)(O)O)P(=O)(O)O)C(P(=O)(O)O)P(=O)(O)O |
| InChI | InChI=1S/C20H45NO12P4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-21(19(34(22,23)24)35(25,26)27)20(36(28,29)30)37(31,32)33/h9-10,19-20H,2-8,11-18H2,1H3,(H2,22,23,24)(H2,25,26,27)(H2,28,29,30)(H2,31,32,33)/b10-9- |
| InChIKey | XLSQVKXIVJCTLL-KTKRTIGZSA-N |
| XLogP | 4.60 |
| TPSA | 233.36 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.47 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|