C12H37N3O25P8 — CID 88894656
[[3-[3-[bis(diphosphonomethyl)amino]propyl-(2-hydroxyethyl)amino]propyl-(diphosphonomethyl)amino]-phosphonomethyl]phosphonic acid (PubChem CID 88894656) has the molecular formula C12H37N3O25P8 and a molecular weight of 871.22 g/mol. Its IUPAC name is [[3-[3-[bis(diphosphonomethyl)amino]propyl-(2-hydroxyethyl)amino]propyl-(diphosphonomethyl)amino]-phosphonomethyl]phosphonic acid.
| Compound Name | [[3-[3-[bis(diphosphonomethyl)amino]propyl-(2-hydroxyethyl)amino]propyl-(diphosphonomethyl)amino]-phosphonomethyl]phosphonic acid |
|---|---|
| PubChem CID | 88894656 |
| Molecular Formula | C12H37N3O25P8 |
| Molecular Weight | 871.22 g/mol |
| Exact Mass | 870.96 |
| IUPAC Name | [[3-[3-[bis(diphosphonomethyl)amino]propyl-(2-hydroxyethyl)amino]propyl-(diphosphonomethyl)amino]-phosphonomethyl]phosphonic acid |
| SMILES | O=P(O)(O)C(N(CCCN(CCO)CCCN(C(P(=O)(O)O)P(=O)(O)O)C(P(=O)(O)O)P(=O)(O)O)C(P(=O)(O)O)P(=O)(O)O)P(=O)(O)O |
| InChI | InChI=1S/C12H37N3O25P8/c16-8-7-13(3-1-5-14(9(41(17,18)19)42(20,21)22)10(43(23,24)25)44(26,27)28)4-2-6-15(11(45(29,30)31)46(32,33)34)12(47(35,36)37)48(38,39)40/h9-12,16H,1-8H2,(H2,17,18,19)(H2,20,21,22)(H2,23,24,25)(H2,26,27,28)(H2,29,30,31)(H2,32,33,34)(H2,35,36,37)(H2,38,39,40) |
| InChIKey | LLUDAMYIMQHLDT-UHFFFAOYSA-N |
| XLogP | -3.78 |
| TPSA | 490.19 Ų |
| H-Bond Donors | 17 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 871.22 |
| LogP ≤ 5 | -3.78 |
| H-Bond Donors ≤ 5 | 17 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|