About 3-[2-hydroxyethyl(3-hydroxypropyl)amino]propan-1-ol;methane
3-[2-hydroxyethyl(3-hydroxypropyl)amino]propan-1-ol;methane (PubChem CID 158407678) has the molecular formula C9H23NO3
and a molecular weight of 193.29 g/mol. Its IUPAC name is 3-[2-hydroxyethyl(3-hydroxypropyl)amino]propan-1-ol;methane.
Molecular Properties
| Compound Name | 3-[2-hydroxyethyl(3-hydroxypropyl)amino]propan-1-ol;methane |
| PubChem CID | 158407678 |
| Molecular Formula | C9H23NO3 |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.17 |
| IUPAC Name | 3-[2-hydroxyethyl(3-hydroxypropyl)amino]propan-1-ol;methane |
| SMILES | C.OCCCN(CCO)CCCO |
| InChI | InChI=1S/C8H19NO3.CH4/c10-6-1-3-9(5-8-12)4-2-7-11;/h10-12H,1-8H2;1H4 |
| InChIKey | GYXCSDQSTKAUGH-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[2-hydroxyethyl(3-hydroxypropyl)amino]propan-1-ol;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-hydroxyethyl(3-hydroxypropyl)amino]propan-1-ol;methane?
The IUPAC name of 3-[2-hydroxyethyl(3-hydroxypropyl)amino]propan-1-ol;methane (CID 158407678) is 3-[2-hydroxyethyl(3-hydroxypropyl)amino]propan-1-ol;methane.
What is the SMILES notation for 3-[2-hydroxyethyl(3-hydroxypropyl)amino]propan-1-ol;methane?
The canonical SMILES for 3-[2-hydroxyethyl(3-hydroxypropyl)amino]propan-1-ol;methane is C.OCCCN(CCO)CCCO.
What is the InChIKey of 3-[2-hydroxyethyl(3-hydroxypropyl)amino]propan-1-ol;methane?
The InChIKey is GYXCSDQSTKAUGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H19NO3.CH4/c10-6-1-3-9(5-8-12)4-2-7-11;/h10-12H,1-8H2;1H4.
What are the key properties of 3-[2-hydroxyethyl(3-hydroxypropyl)amino]propan-1-ol;methane?
3-[2-hydroxyethyl(3-hydroxypropyl)amino]propan-1-ol;methane has a molecular weight of 193.29 g/mol, XLogP of -0.32, 8 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-hydroxyethyl(3-hydroxypropyl)amino]propan-1-ol;methane is sourced from PubChem (CID 158407678), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).