C6H11NO4S — CID 87532574
(2R)-2-[carboxy(methyl)amino]-2-methyl-3-sulfanylpropanoic acid (PubChem CID 87532574) has the molecular formula C6H11NO4S and a molecular weight of 193.22 g/mol. Its IUPAC name is (2R)-2-[carboxy(methyl)amino]-2-methyl-3-sulfanylpropanoic acid.
| Compound Name | (2R)-2-[carboxy(methyl)amino]-2-methyl-3-sulfanylpropanoic acid |
|---|---|
| PubChem CID | 87532574 |
| Molecular Formula | C6H11NO4S |
| Molecular Weight | 193.22 g/mol |
| Exact Mass | 193.04 |
| IUPAC Name | (2R)-2-[carboxy(methyl)amino]-2-methyl-3-sulfanylpropanoic acid |
| SMILES | CN(C(=O)O)[C@@](C)(CS)C(=O)O |
| InChI | InChI=1S/C6H11NO4S/c1-6(3-12,4(8)9)7(2)5(10)11/h12H,3H2,1-2H3,(H,8,9)(H,10,11)/t6-/m0/s1 |
| InChIKey | UYXCBPYFZPYLNO-LURJTMIESA-N |
| XLogP | 0.37 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.22 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|