C6H12N2O4S — CID 87123597
[1-(carboxyamino)-1-methylsulfanylethyl]-methylcarbamic acid (PubChem CID 87123597) has the molecular formula C6H12N2O4S and a molecular weight of 208.24 g/mol. Its IUPAC name is [1-(carboxyamino)-1-methylsulfanylethyl]-methylcarbamic acid.
| Compound Name | [1-(carboxyamino)-1-methylsulfanylethyl]-methylcarbamic acid |
|---|---|
| PubChem CID | 87123597 |
| Molecular Formula | C6H12N2O4S |
| Molecular Weight | 208.24 g/mol |
| Exact Mass | 208.05 |
| IUPAC Name | [1-(carboxyamino)-1-methylsulfanylethyl]-methylcarbamic acid |
| SMILES | CSC(C)(NC(=O)O)N(C)C(=O)O |
| InChI | InChI=1S/C6H12N2O4S/c1-6(13-3,7-4(9)10)8(2)5(11)12/h7H,1-3H3,(H,9,10)(H,11,12) |
| InChIKey | HPBJJQKJWUUUPY-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.24 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|