C14H29N3O3 — CID 144530194
[1-[2-(2,2-dimethylbutylamino)ethylamino]-2-methyl-1-oxopropan-2-yl]-methylcarbamic acid (PubChem CID 144530194) has the molecular formula C14H29N3O3 and a molecular weight of 287.40 g/mol. Its IUPAC name is [1-[2-(2,2-dimethylbutylamino)ethylamino]-2-methyl-1-oxopropan-2-yl]-methylcarbamic acid.
| Compound Name | [1-[2-(2,2-dimethylbutylamino)ethylamino]-2-methyl-1-oxopropan-2-yl]-methylcarbamic acid |
|---|---|
| PubChem CID | 144530194 |
| Molecular Formula | C14H29N3O3 |
| Molecular Weight | 287.40 g/mol |
| Exact Mass | 287.22 |
| IUPAC Name | [1-[2-(2,2-dimethylbutylamino)ethylamino]-2-methyl-1-oxopropan-2-yl]-methylcarbamic acid |
| SMILES | CCC(C)(C)CNCCNC(=O)C(C)(C)N(C)C(=O)O |
| InChI | InChI=1S/C14H29N3O3/c1-7-13(2,3)10-15-8-9-16-11(18)14(4,5)17(6)12(19)20/h15H,7-10H2,1-6H3,(H,16,18)(H,19,20) |
| InChIKey | RATPTAQEBNHPOJ-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.40 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|