About N-[2-(2,2-dimethylbutylamino)ethyl]-2-methylpropanamide
N-[2-(2,2-dimethylbutylamino)ethyl]-2-methylpropanamide (PubChem CID 146594177) has the molecular formula C12H26N2O
and a molecular weight of 214.35 g/mol. Its IUPAC name is N-[2-(2,2-dimethylbutylamino)ethyl]-2-methylpropanamide.
Molecular Properties
| Compound Name | N-[2-(2,2-dimethylbutylamino)ethyl]-2-methylpropanamide |
| PubChem CID | 146594177 |
| Molecular Formula | C12H26N2O |
| Molecular Weight | 214.35 g/mol |
| Exact Mass | 214.20 |
| IUPAC Name | N-[2-(2,2-dimethylbutylamino)ethyl]-2-methylpropanamide |
| SMILES | CCC(C)(C)CNCCNC(=O)C(C)C |
| InChI | InChI=1S/C12H26N2O/c1-6-12(4,5)9-13-7-8-14-11(15)10(2)3/h10,13H,6-9H2,1-5H3,(H,14,15) |
| InChIKey | XGUWYCKBNVTGRS-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.35 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[2-(2,2-dimethylbutylamino)ethyl]-2-methylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(2,2-dimethylbutylamino)ethyl]-2-methylpropanamide?
The IUPAC name of N-[2-(2,2-dimethylbutylamino)ethyl]-2-methylpropanamide (CID 146594177) is N-[2-(2,2-dimethylbutylamino)ethyl]-2-methylpropanamide.
What is the SMILES notation for N-[2-(2,2-dimethylbutylamino)ethyl]-2-methylpropanamide?
The canonical SMILES for N-[2-(2,2-dimethylbutylamino)ethyl]-2-methylpropanamide is CCC(C)(C)CNCCNC(=O)C(C)C.
What is the InChIKey of N-[2-(2,2-dimethylbutylamino)ethyl]-2-methylpropanamide?
The InChIKey is XGUWYCKBNVTGRS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H26N2O/c1-6-12(4,5)9-13-7-8-14-11(15)10(2)3/h10,13H,6-9H2,1-5H3,(H,14,15).
What are the key properties of N-[2-(2,2-dimethylbutylamino)ethyl]-2-methylpropanamide?
N-[2-(2,2-dimethylbutylamino)ethyl]-2-methylpropanamide has a molecular weight of 214.35 g/mol, XLogP of 1.78, 7 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(2,2-dimethylbutylamino)ethyl]-2-methylpropanamide is sourced from PubChem (CID 146594177), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).