C11H22N2O9P2 — CID 87501515
(2R)-5-amino-2-[bis(1-phosphonoprop-2-enyl)amino]-2-hydroxypentanoic acid (PubChem CID 87501515) has the molecular formula C11H22N2O9P2 and a molecular weight of 388.25 g/mol. Its IUPAC name is (2R)-5-amino-2-[bis(1-phosphonoprop-2-enyl)amino]-2-hydroxypentanoic acid.
| Compound Name | (2R)-5-amino-2-[bis(1-phosphonoprop-2-enyl)amino]-2-hydroxypentanoic acid |
|---|---|
| PubChem CID | 87501515 |
| Molecular Formula | C11H22N2O9P2 |
| Molecular Weight | 388.25 g/mol |
| Exact Mass | 388.08 |
| IUPAC Name | (2R)-5-amino-2-[bis(1-phosphonoprop-2-enyl)amino]-2-hydroxypentanoic acid |
| SMILES | C=CC(N(C(C=C)P(=O)(O)O)[C@@](O)(CCCN)C(=O)O)P(=O)(O)O |
| InChI | InChI=1S/C11H22N2O9P2/c1-3-8(23(17,18)19)13(9(4-2)24(20,21)22)11(16,10(14)15)6-5-7-12/h3-4,8-9,16H,1-2,5-7,12H2,(H,14,15)(H2,17,18,19)(H2,20,21,22)/t8?,9?,11-/m1/s1 |
| InChIKey | TYDCORWHPUEDMO-NWGYLPEXSA-N |
| XLogP | -0.82 |
| TPSA | 201.85 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.25 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|