C11H21NO9P2 — CID 87493639
2-[bis(1-phosphonoprop-2-enyl)amino]-2-hydroxy-3-methylbutanoic acid (PubChem CID 87493639) has the molecular formula C11H21NO9P2 and a molecular weight of 373.24 g/mol. Its IUPAC name is 2-[bis(1-phosphonoprop-2-enyl)amino]-2-hydroxy-3-methylbutanoic acid.
| Compound Name | 2-[bis(1-phosphonoprop-2-enyl)amino]-2-hydroxy-3-methylbutanoic acid |
|---|---|
| PubChem CID | 87493639 |
| Molecular Formula | C11H21NO9P2 |
| Molecular Weight | 373.24 g/mol |
| Exact Mass | 373.07 |
| IUPAC Name | 2-[bis(1-phosphonoprop-2-enyl)amino]-2-hydroxy-3-methylbutanoic acid |
| SMILES | C=CC(N(C(C=C)P(=O)(O)O)C(O)(C(=O)O)C(C)C)P(=O)(O)O |
| InChI | InChI=1S/C11H21NO9P2/c1-5-8(22(16,17)18)12(9(6-2)23(19,20)21)11(15,7(3)4)10(13)14/h5-9,15H,1-2H2,3-4H3,(H,13,14)(H2,16,17,18)(H2,19,20,21) |
| InChIKey | WXPBYCJYQYZQCC-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 175.83 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.24 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|