C8H14NO8P — CID 87475629
(2S)-2-[hydroxy(1-phosphonoprop-2-enyl)amino]pentanedioic acid (PubChem CID 87475629) has the molecular formula C8H14NO8P and a molecular weight of 283.17 g/mol. Its IUPAC name is (2S)-2-[hydroxy(1-phosphonoprop-2-enyl)amino]pentanedioic acid.
| Compound Name | (2S)-2-[hydroxy(1-phosphonoprop-2-enyl)amino]pentanedioic acid |
|---|---|
| PubChem CID | 87475629 |
| Molecular Formula | C8H14NO8P |
| Molecular Weight | 283.17 g/mol |
| Exact Mass | 283.05 |
| IUPAC Name | (2S)-2-[hydroxy(1-phosphonoprop-2-enyl)amino]pentanedioic acid |
| SMILES | C=CC(N(O)[C@@H](CCC(=O)O)C(=O)O)P(=O)(O)O |
| InChI | InChI=1S/C8H14NO8P/c1-2-6(18(15,16)17)9(14)5(8(12)13)3-4-7(10)11/h2,5-6,14H,1,3-4H2,(H,10,11)(H,12,13)(H2,15,16,17)/t5-,6?/m0/s1 |
| InChIKey | CBUNNKDQHFPDIT-ZBHICJROSA-N |
| XLogP | -0.31 |
| TPSA | 155.60 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.17 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|