C9H18N4O5 — CID 172565564
2-amino-2-[3-(diaminomethylideneamino)propyl]-3-hydroxy-3-methylbutanedioic acid (PubChem CID 172565564) has the molecular formula C9H18N4O5 and a molecular weight of 262.27 g/mol. Its IUPAC name is 2-amino-2-[3-(diaminomethylideneamino)propyl]-3-hydroxy-3-methylbutanedioic acid.
| Compound Name | 2-amino-2-[3-(diaminomethylideneamino)propyl]-3-hydroxy-3-methylbutanedioic acid |
|---|---|
| PubChem CID | 172565564 |
| Molecular Formula | C9H18N4O5 |
| Molecular Weight | 262.27 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | 2-amino-2-[3-(diaminomethylideneamino)propyl]-3-hydroxy-3-methylbutanedioic acid |
| SMILES | CC(O)(C(=O)O)C(N)(CCCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C9H18N4O5/c1-8(18,5(14)15)9(12,6(16)17)3-2-4-13-7(10)11/h18H,2-4,12H2,1H3,(H,14,15)(H,16,17)(H4,10,11,13) |
| InChIKey | WRTGTFDDMPLAIO-UHFFFAOYSA-N |
| XLogP | -2.34 |
| TPSA | 185.25 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.27 |
| LogP ≤ 5 | -2.34 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|