C9H14N4O4P2 — CID 141183167
(2S)-5-(diaminomethylideneamino)-2-[methyl-[(oxo-λ5-phosphanylidyne)methyl]amino]-2-[(oxo-λ5-phosphanylidyne)methyl]pentanoic acid (PubChem CID 141183167) has the molecular formula C9H14N4O4P2 and a molecular weight of 304.18 g/mol. Its IUPAC name is (2S)-5-(diaminomethylideneamino)-2-[methyl-[(oxo-λ5-phosphanylidyne)methyl]amino]-2-[(oxo-λ5-phosphanylidyne)methyl]pentanoic acid.
| Compound Name | (2S)-5-(diaminomethylideneamino)-2-[methyl-[(oxo-λ5-phosphanylidyne)methyl]amino]-2-[(oxo-λ5-phosphanylidyne)methyl]pentanoic acid |
|---|---|
| PubChem CID | 141183167 |
| Molecular Formula | C9H14N4O4P2 |
| Molecular Weight | 304.18 g/mol |
| Exact Mass | 304.05 |
| IUPAC Name | (2S)-5-(diaminomethylideneamino)-2-[methyl-[(oxo-λ5-phosphanylidyne)methyl]amino]-2-[(oxo-λ5-phosphanylidyne)methyl]pentanoic acid |
| SMILES | CN(C#P=O)[C@@](C#P=O)(CCCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C9H14N4O4P2/c1-13(6-19-17)9(5-18-16,7(14)15)3-2-4-12-8(10)11/h2-4H2,1H3,(H,14,15)(H4,10,11,12)/t9-/m1/s1 |
| InChIKey | WPBHWCSSNJCZLA-SECBINFHSA-N |
| XLogP | 0.25 |
| TPSA | 139.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.18 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|