C11H22N4O3 — CID 175056196
(2R)-2-amino-2-[3-(diaminomethylideneamino)propyl]-3-oxoheptanoic acid (PubChem CID 175056196) has the molecular formula C11H22N4O3 and a molecular weight of 258.32 g/mol. Its IUPAC name is (2R)-2-amino-2-[3-(diaminomethylideneamino)propyl]-3-oxoheptanoic acid.
| Compound Name | (2R)-2-amino-2-[3-(diaminomethylideneamino)propyl]-3-oxoheptanoic acid |
|---|---|
| PubChem CID | 175056196 |
| Molecular Formula | C11H22N4O3 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.17 |
| IUPAC Name | (2R)-2-amino-2-[3-(diaminomethylideneamino)propyl]-3-oxoheptanoic acid |
| SMILES | CCCCC(=O)[C@](N)(CCCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C11H22N4O3/c1-2-3-5-8(16)11(14,9(17)18)6-4-7-15-10(12)13/h2-7,14H2,1H3,(H,17,18)(H4,12,13,15)/t11-/m1/s1 |
| InChIKey | OPUYNMXQBMUISF-LLVKDONJSA-N |
| XLogP | -0.42 |
| TPSA | 144.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|