C13H24N4O2 — CID 57364794
tert-butyl-[7-(diaminomethylideneamino)hept-3-ynyl]carbamic acid (PubChem CID 57364794) has the molecular formula C13H24N4O2 and a molecular weight of 268.36 g/mol. Its IUPAC name is tert-butyl-[7-(diaminomethylideneamino)hept-3-ynyl]carbamic acid.
| Compound Name | tert-butyl-[7-(diaminomethylideneamino)hept-3-ynyl]carbamic acid |
|---|---|
| PubChem CID | 57364794 |
| Molecular Formula | C13H24N4O2 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.19 |
| IUPAC Name | tert-butyl-[7-(diaminomethylideneamino)hept-3-ynyl]carbamic acid |
| SMILES | CC(C)(C)N(CCC#CCCCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C13H24N4O2/c1-13(2,3)17(12(18)19)10-8-6-4-5-7-9-16-11(14)15/h5,7-10H2,1-3H3,(H,18,19)(H4,14,15,16) |
| InChIKey | OQBMMSTWJZDOGE-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 104.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|