C9H19N5O4 — CID 57324197
(2R)-2-amino-2-[carboxymethyl(methyl)amino]-5-(diaminomethylideneamino)pentanoic acid (PubChem CID 57324197) has the molecular formula C9H19N5O4 and a molecular weight of 261.28 g/mol. Its IUPAC name is (2R)-2-amino-2-[carboxymethyl(methyl)amino]-5-(diaminomethylideneamino)pentanoic acid.
| Compound Name | (2R)-2-amino-2-[carboxymethyl(methyl)amino]-5-(diaminomethylideneamino)pentanoic acid |
|---|---|
| PubChem CID | 57324197 |
| Molecular Formula | C9H19N5O4 |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.14 |
| IUPAC Name | (2R)-2-amino-2-[carboxymethyl(methyl)amino]-5-(diaminomethylideneamino)pentanoic acid |
| SMILES | CN(CC(=O)O)[C@](N)(CCCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C9H19N5O4/c1-14(5-6(15)16)9(12,7(17)18)3-2-4-13-8(10)11/h2-5,12H2,1H3,(H,15,16)(H,17,18)(H4,10,11,13)/t9-/m1/s1 |
| InChIKey | YIDRGHBCTQOZIP-SECBINFHSA-N |
| XLogP | -2.20 |
| TPSA | 168.26 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | -2.20 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|