C13H28N4O — CID 166644701
2-[(4S)-4-amino-5,5,8-trimethyl-7-oxononyl]guanidine (PubChem CID 166644701) has the molecular formula C13H28N4O and a molecular weight of 256.39 g/mol. Its IUPAC name is 2-[(4S)-4-amino-5,5,8-trimethyl-7-oxononyl]guanidine.
| Compound Name | 2-[(4S)-4-amino-5,5,8-trimethyl-7-oxononyl]guanidine |
|---|---|
| PubChem CID | 166644701 |
| Molecular Formula | C13H28N4O |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.23 |
| IUPAC Name | 2-[(4S)-4-amino-5,5,8-trimethyl-7-oxononyl]guanidine |
| SMILES | CC(C)C(=O)CC(C)(C)[C@@H](N)CCCN=C(N)N |
| InChI | InChI=1S/C13H28N4O/c1-9(2)10(18)8-13(3,4)11(14)6-5-7-17-12(15)16/h9,11H,5-8,14H2,1-4H3,(H4,15,16,17)/t11-/m0/s1 |
| InChIKey | ZCHAUPBCTGEBBI-NSHDSACASA-N |
| XLogP | 1.01 |
| TPSA | 107.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|