C10H22N6O — CID 153423260
2-[(4S)-1-(diaminomethylideneamino)-6-methyl-5-oxoheptan-4-yl]guanidine (PubChem CID 153423260) has the molecular formula C10H22N6O and a molecular weight of 242.33 g/mol. Its IUPAC name is 2-[(4S)-1-(diaminomethylideneamino)-6-methyl-5-oxoheptan-4-yl]guanidine.
| Compound Name | 2-[(4S)-1-(diaminomethylideneamino)-6-methyl-5-oxoheptan-4-yl]guanidine |
|---|---|
| PubChem CID | 153423260 |
| Molecular Formula | C10H22N6O |
| Molecular Weight | 242.33 g/mol |
| Exact Mass | 242.19 |
| IUPAC Name | 2-[(4S)-1-(diaminomethylideneamino)-6-methyl-5-oxoheptan-4-yl]guanidine |
| SMILES | CC(C)C(=O)[C@H](CCCN=C(N)N)N=C(N)N |
| InChI | InChI=1S/C10H22N6O/c1-6(2)8(17)7(16-10(13)14)4-3-5-15-9(11)12/h6-7H,3-5H2,1-2H3,(H4,11,12,15)(H4,13,14,16)/t7-/m0/s1 |
| InChIKey | FWNKDSXGLGTWLK-ZETCQYMHSA-N |
| XLogP | -1.09 |
| TPSA | 145.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.33 |
| LogP ≤ 5 | -1.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|