C10H27N4O4P — CID 88668506
[8-(diaminomethylideneamino)octylamino]methylphosphonic acid;hydrate (PubChem CID 88668506) has the molecular formula C10H27N4O4P and a molecular weight of 298.32 g/mol. Its IUPAC name is [8-(diaminomethylideneamino)octylamino]methylphosphonic acid;hydrate.
| Compound Name | [8-(diaminomethylideneamino)octylamino]methylphosphonic acid;hydrate |
|---|---|
| PubChem CID | 88668506 |
| Molecular Formula | C10H27N4O4P |
| Molecular Weight | 298.32 g/mol |
| Exact Mass | 298.18 |
| IUPAC Name | [8-(diaminomethylideneamino)octylamino]methylphosphonic acid;hydrate |
| SMILES | NC(N)=NCCCCCCCCNCP(=O)(O)O.O |
| InChI | InChI=1S/C10H25N4O3P.H2O/c11-10(12)14-8-6-4-2-1-3-5-7-13-9-18(15,16)17;/h13H,1-9H2,(H4,11,12,14)(H2,15,16,17);1H2 |
| InChIKey | ZCDDLOPSJVIADW-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 165.46 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.32 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|