C10H28N3O9P3 — CID 158337089
[5-[2-[bis(phosphonomethyl)amino]ethylamino]pentylamino]methylphosphonic acid (PubChem CID 158337089) has the molecular formula C10H28N3O9P3 and a molecular weight of 427.27 g/mol. Its IUPAC name is [5-[2-[bis(phosphonomethyl)amino]ethylamino]pentylamino]methylphosphonic acid.
| Compound Name | [5-[2-[bis(phosphonomethyl)amino]ethylamino]pentylamino]methylphosphonic acid |
|---|---|
| PubChem CID | 158337089 |
| Molecular Formula | C10H28N3O9P3 |
| Molecular Weight | 427.27 g/mol |
| Exact Mass | 427.10 |
| IUPAC Name | [5-[2-[bis(phosphonomethyl)amino]ethylamino]pentylamino]methylphosphonic acid |
| SMILES | O=P(O)(O)CNCCCCCNCCN(CP(=O)(O)O)CP(=O)(O)O |
| InChI | InChI=1S/C10H28N3O9P3/c14-23(15,16)8-12-5-3-1-2-4-11-6-7-13(9-24(17,18)19)10-25(20,21)22/h11-12H,1-10H2,(H2,14,15,16)(H2,17,18,19)(H2,20,21,22) |
| InChIKey | BFCPQHQQKHBQPQ-UHFFFAOYSA-N |
| XLogP | -0.96 |
| TPSA | 199.89 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.27 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|