C22H36N12O — CID 86300974
10-azido-N-[3-[(E)-N-(diaminomethylideneamino)-C-methylcarbonimidoyl]-5-[(Z)-N-(diaminomethylideneamino)-C-methylcarbonimidoyl]phenyl]decanamide (PubChem CID 86300974) has the molecular formula C22H36N12O and a molecular weight of 484.61 g/mol. Its IUPAC name is 10-azido-N-[3-[(E)-N-(diaminomethylideneamino)-C-methylcarbonimidoyl]-5-[(Z)-N-(diaminomethylideneamino)-C-methylcarbonimidoyl]phenyl]decanamide.
| Compound Name | 10-azido-N-[3-[(E)-N-(diaminomethylideneamino)-C-methylcarbonimidoyl]-5-[(Z)-N-(diaminomethylideneamino)-C-methylcarbonimidoyl]phenyl]decanamide |
|---|---|
| PubChem CID | 86300974 |
| Molecular Formula | C22H36N12O |
| Molecular Weight | 484.61 g/mol |
| Exact Mass | 484.31 |
| IUPAC Name | 10-azido-N-[3-[(E)-N-(diaminomethylideneamino)-C-methylcarbonimidoyl]-5-[(Z)-N-(diaminomethylideneamino)-C-methylcarbonimidoyl]phenyl]decanamide |
| SMILES | C/C(=N/N=C(N)N)c1cc(NC(=O)CCCCCCCCCN=[N+]=[N-])cc(/C(C)=N/N=C(N)N)c1 |
| InChI | InChI=1S/C22H36N12O/c1-15(30-32-21(23)24)17-12-18(16(2)31-33-22(25)26)14-19(13-17)29-20(35)10-8-6-4-3-5-7-9-11-28-34-27/h12-14H,3-11H2,1-2H3,(H,29,35)(H4,23,24,32)(H4,25,26,33)/b30-15-,31-16+ |
| InChIKey | REGIEESXAJOZFR-IOMVTZLUSA-N |
| XLogP | 3.05 |
| TPSA | 231.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.61 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|