C10H15ClN6S — CID 54600853
[4-[(E)-N-(diaminomethylideneamino)-C-methylcarbonimidoyl]phenyl]thiourea;hydrochloride (PubChem CID 54600853) has the molecular formula C10H15ClN6S and a molecular weight of 286.79 g/mol. Its IUPAC name is [4-[(E)-N-(diaminomethylideneamino)-C-methylcarbonimidoyl]phenyl]thiourea;hydrochloride.
| Compound Name | [4-[(E)-N-(diaminomethylideneamino)-C-methylcarbonimidoyl]phenyl]thiourea;hydrochloride |
|---|---|
| PubChem CID | 54600853 |
| Molecular Formula | C10H15ClN6S |
| Molecular Weight | 286.79 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | [4-[(E)-N-(diaminomethylideneamino)-C-methylcarbonimidoyl]phenyl]thiourea;hydrochloride |
| SMILES | C/C(=N\N=C(N)N)c1ccc(NC(N)=S)cc1.Cl |
| InChI | InChI=1S/C10H14N6S.ClH/c1-6(15-16-9(11)12)7-2-4-8(5-3-7)14-10(13)17;/h2-5H,1H3,(H4,11,12,16)(H3,13,14,17);1H/b15-6+; |
| InChIKey | NIDJHSWMAVQHKT-AWXXIEIHSA-N |
| XLogP | 0.76 |
| TPSA | 114.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.79 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|