C17H18N8O5S — CID 67689366
N-(diaminomethylidene)-3-[[4-(diaminomethylidenecarbamoyl)phenyl]sulfonylcarbamoylamino]benzamide (PubChem CID 67689366) has the molecular formula C17H18N8O5S and a molecular weight of 446.45 g/mol. Its IUPAC name is N-(diaminomethylidene)-3-[[4-(diaminomethylidenecarbamoyl)phenyl]sulfonylcarbamoylamino]benzamide.
| Compound Name | N-(diaminomethylidene)-3-[[4-(diaminomethylidenecarbamoyl)phenyl]sulfonylcarbamoylamino]benzamide |
|---|---|
| PubChem CID | 67689366 |
| Molecular Formula | C17H18N8O5S |
| Molecular Weight | 446.45 g/mol |
| Exact Mass | 446.11 |
| IUPAC Name | N-(diaminomethylidene)-3-[[4-(diaminomethylidenecarbamoyl)phenyl]sulfonylcarbamoylamino]benzamide |
| SMILES | NC(N)=NC(=O)c1ccc(S(=O)(=O)NC(=O)Nc2cccc(C(=O)N=C(N)N)c2)cc1 |
| InChI | InChI=1S/C17H18N8O5S/c18-15(19)23-13(26)9-4-6-12(7-5-9)31(29,30)25-17(28)22-11-3-1-2-10(8-11)14(27)24-16(20)21/h1-8H,(H2,22,25,28)(H4,18,19,23,26)(H4,20,21,24,27) |
| InChIKey | HUOHKEMRKNDEBV-UHFFFAOYSA-N |
| XLogP | -0.98 |
| TPSA | 238.21 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.45 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|