C20H24N4O6S2 — CID 87975674
4-(carbamoylamino)sulfanylbutyl 3-[(4-methylphenyl)sulfonylcarbamoylamino]benzoate (PubChem CID 87975674) has the molecular formula C20H24N4O6S2 and a molecular weight of 480.57 g/mol. Its IUPAC name is 4-(carbamoylamino)sulfanylbutyl 3-[(4-methylphenyl)sulfonylcarbamoylamino]benzoate.
| Compound Name | 4-(carbamoylamino)sulfanylbutyl 3-[(4-methylphenyl)sulfonylcarbamoylamino]benzoate |
|---|---|
| PubChem CID | 87975674 |
| Molecular Formula | C20H24N4O6S2 |
| Molecular Weight | 480.57 g/mol |
| Exact Mass | 480.11 |
| IUPAC Name | 4-(carbamoylamino)sulfanylbutyl 3-[(4-methylphenyl)sulfonylcarbamoylamino]benzoate |
| SMILES | Cc1ccc(S(=O)(=O)NC(=O)Nc2cccc(C(=O)OCCCCSNC(N)=O)c2)cc1 |
| InChI | InChI=1S/C20H24N4O6S2/c1-14-7-9-17(10-8-14)32(28,29)24-20(27)22-16-6-4-5-15(13-16)18(25)30-11-2-3-12-31-23-19(21)26/h4-10,13H,2-3,11-12H2,1H3,(H3,21,23,26)(H2,22,24,27) |
| InChIKey | BPCINOZDQNSWMK-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 156.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.57 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|