C36H38N4O12S2 — CID 90797650
2-[2-[2-[3-[(3-methylphenyl)sulfonylcarbamoylamino]benzoyl]oxyethoxy]ethoxy]ethyl 3-[(3-methylphenyl)sulfonylcarbamoylamino]benzoate (PubChem CID 90797650) has the molecular formula C36H38N4O12S2 and a molecular weight of 782.85 g/mol. Its IUPAC name is 2-[2-[2-[3-[(3-methylphenyl)sulfonylcarbamoylamino]benzoyl]oxyethoxy]ethoxy]ethyl 3-[(3-methylphenyl)sulfonylcarbamoylamino]benzoate.
| Compound Name | 2-[2-[2-[3-[(3-methylphenyl)sulfonylcarbamoylamino]benzoyl]oxyethoxy]ethoxy]ethyl 3-[(3-methylphenyl)sulfonylcarbamoylamino]benzoate |
|---|---|
| PubChem CID | 90797650 |
| Molecular Formula | C36H38N4O12S2 |
| Molecular Weight | 782.85 g/mol |
| Exact Mass | 782.19 |
| IUPAC Name | 2-[2-[2-[3-[(3-methylphenyl)sulfonylcarbamoylamino]benzoyl]oxyethoxy]ethoxy]ethyl 3-[(3-methylphenyl)sulfonylcarbamoylamino]benzoate |
| SMILES | Cc1cccc(S(=O)(=O)NC(=O)Nc2cccc(C(=O)OCCOCCOCCOC(=O)c3cccc(NC(=O)NS(=O)(=O)c4cccc(C)c4)c3)c2)c1 |
| InChI | InChI=1S/C36H38N4O12S2/c1-25-7-3-13-31(21-25)53(45,46)39-35(43)37-29-11-5-9-27(23-29)33(41)51-19-17-49-15-16-50-18-20-52-34(42)28-10-6-12-30(24-28)38-36(44)40-54(47,48)32-14-4-8-26(2)22-32/h3-14,21-24H,15-20H2,1-2H3,(H2,37,39,43)(H2,38,40,44) |
| InChIKey | JZBBTNXGCGWCLT-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 221.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 782.85 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|