C21H26N2O7S — CID 173209029
2-[2-(2-ethoxyethoxy)ethyl]-3-[(3-methylphenyl)sulfonylcarbamoylamino]benzoic acid (PubChem CID 173209029) has the molecular formula C21H26N2O7S and a molecular weight of 450.51 g/mol. Its IUPAC name is 2-[2-(2-ethoxyethoxy)ethyl]-3-[(3-methylphenyl)sulfonylcarbamoylamino]benzoic acid.
| Compound Name | 2-[2-(2-ethoxyethoxy)ethyl]-3-[(3-methylphenyl)sulfonylcarbamoylamino]benzoic acid |
|---|---|
| PubChem CID | 173209029 |
| Molecular Formula | C21H26N2O7S |
| Molecular Weight | 450.51 g/mol |
| Exact Mass | 450.15 |
| IUPAC Name | 2-[2-(2-ethoxyethoxy)ethyl]-3-[(3-methylphenyl)sulfonylcarbamoylamino]benzoic acid |
| SMILES | CCOCCOCCc1c(NC(=O)NS(=O)(=O)c2cccc(C)c2)cccc1C(=O)O |
| InChI | InChI=1S/C21H26N2O7S/c1-3-29-12-13-30-11-10-17-18(20(24)25)8-5-9-19(17)22-21(26)23-31(27,28)16-7-4-6-15(2)14-16/h4-9,14H,3,10-13H2,1-2H3,(H,24,25)(H2,22,23,26) |
| InChIKey | ZVSMATKJRRQYRS-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 131.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.51 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|