C14H15N2O6PS — CID 90890500
[3-[(4-methylphenyl)sulfonylcarbamoylamino]phenyl]phosphonic acid (PubChem CID 90890500) has the molecular formula C14H15N2O6PS and a molecular weight of 370.32 g/mol. Its IUPAC name is [3-[(4-methylphenyl)sulfonylcarbamoylamino]phenyl]phosphonic acid.
| Compound Name | [3-[(4-methylphenyl)sulfonylcarbamoylamino]phenyl]phosphonic acid |
|---|---|
| PubChem CID | 90890500 |
| Molecular Formula | C14H15N2O6PS |
| Molecular Weight | 370.32 g/mol |
| Exact Mass | 370.04 |
| IUPAC Name | [3-[(4-methylphenyl)sulfonylcarbamoylamino]phenyl]phosphonic acid |
| SMILES | Cc1ccc(S(=O)(=O)NC(=O)Nc2cccc(P(=O)(O)O)c2)cc1 |
| InChI | InChI=1S/C14H15N2O6PS/c1-10-5-7-13(8-6-10)24(21,22)16-14(17)15-11-3-2-4-12(9-11)23(18,19)20/h2-9H,1H3,(H2,15,16,17)(H2,18,19,20) |
| InChIKey | DLIIYAZZJNEHKI-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 132.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.32 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|