C22H21N3O4S — CID 22441702
4-methyl-N-[4-[(3-methylphenyl)carbamoylamino]phenyl]sulfonylbenzamide (PubChem CID 22441702) has the molecular formula C22H21N3O4S and a molecular weight of 423.49 g/mol. Its IUPAC name is 4-methyl-N-[4-[(3-methylphenyl)carbamoylamino]phenyl]sulfonylbenzamide.
| Compound Name | 4-methyl-N-[4-[(3-methylphenyl)carbamoylamino]phenyl]sulfonylbenzamide |
|---|---|
| PubChem CID | 22441702 |
| Molecular Formula | C22H21N3O4S |
| Molecular Weight | 423.49 g/mol |
| Exact Mass | 423.13 |
| IUPAC Name | 4-methyl-N-[4-[(3-methylphenyl)carbamoylamino]phenyl]sulfonylbenzamide |
| SMILES | Cc1ccc(C(=O)NS(=O)(=O)c2ccc(NC(=O)Nc3cccc(C)c3)cc2)cc1 |
| InChI | InChI=1S/C22H21N3O4S/c1-15-6-8-17(9-7-15)21(26)25-30(28,29)20-12-10-18(11-13-20)23-22(27)24-19-5-3-4-16(2)14-19/h3-14H,1-2H3,(H,25,26)(H2,23,24,27) |
| InChIKey | SJXYEXRDYLVDFJ-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.49 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |