C15H15Cl2N5O2 — CID 67770937
3-(N-carbamoylanilino)-4-chloro-N-(diaminomethylidene)benzamide;hydrochloride (PubChem CID 67770937) has the molecular formula C15H15Cl2N5O2 and a molecular weight of 368.22 g/mol. Its IUPAC name is 3-(N-carbamoylanilino)-4-chloro-N-(diaminomethylidene)benzamide;hydrochloride.
| Compound Name | 3-(N-carbamoylanilino)-4-chloro-N-(diaminomethylidene)benzamide;hydrochloride |
|---|---|
| PubChem CID | 67770937 |
| Molecular Formula | C15H15Cl2N5O2 |
| Molecular Weight | 368.22 g/mol |
| Exact Mass | 367.06 |
| IUPAC Name | 3-(N-carbamoylanilino)-4-chloro-N-(diaminomethylidene)benzamide;hydrochloride |
| SMILES | Cl.NC(=O)N(c1ccccc1)c1cc(C(=O)N=C(N)N)ccc1Cl |
| InChI | InChI=1S/C15H14ClN5O2.ClH/c16-11-7-6-9(13(22)20-14(17)18)8-12(11)21(15(19)23)10-4-2-1-3-5-10;/h1-8H,(H2,19,23)(H4,17,18,20,22);1H |
| InChIKey | KNAFBZDRVVVZDL-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 127.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.22 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|