C20H14Cl4N4O2 — CID 138112353
1-[3-(N-carbamoyl-2,4-dichloroanilino)phenyl]-1-(2,4-dichlorophenyl)urea (PubChem CID 138112353) has the molecular formula C20H14Cl4N4O2 and a molecular weight of 484.17 g/mol. Its IUPAC name is 1-[3-(N-carbamoyl-2,4-dichloroanilino)phenyl]-1-(2,4-dichlorophenyl)urea.
| Compound Name | 1-[3-(N-carbamoyl-2,4-dichloroanilino)phenyl]-1-(2,4-dichlorophenyl)urea |
|---|---|
| PubChem CID | 138112353 |
| Molecular Formula | C20H14Cl4N4O2 |
| Molecular Weight | 484.17 g/mol |
| Exact Mass | 481.99 |
| IUPAC Name | 1-[3-(N-carbamoyl-2,4-dichloroanilino)phenyl]-1-(2,4-dichlorophenyl)urea |
| SMILES | NC(=O)N(c1cccc(N(C(N)=O)c2ccc(Cl)cc2Cl)c1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C20H14Cl4N4O2/c21-11-4-6-17(15(23)8-11)27(19(25)29)13-2-1-3-14(10-13)28(20(26)30)18-7-5-12(22)9-16(18)24/h1-10H,(H2,25,29)(H2,26,30) |
| InChIKey | PFQBUMZAYKAVPT-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 92.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.17 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |