C11H17Cl3N4O2 — CID 22076632
3-chloro-N-(diaminomethylidene)-5-(dimethylamino)-4-methoxybenzamide;dihydrochloride (PubChem CID 22076632) has the molecular formula C11H17Cl3N4O2 and a molecular weight of 343.64 g/mol. Its IUPAC name is 3-chloro-N-(diaminomethylidene)-5-(dimethylamino)-4-methoxybenzamide;dihydrochloride.
| Compound Name | 3-chloro-N-(diaminomethylidene)-5-(dimethylamino)-4-methoxybenzamide;dihydrochloride |
|---|---|
| PubChem CID | 22076632 |
| Molecular Formula | C11H17Cl3N4O2 |
| Molecular Weight | 343.64 g/mol |
| Exact Mass | 342.04 |
| IUPAC Name | 3-chloro-N-(diaminomethylidene)-5-(dimethylamino)-4-methoxybenzamide;dihydrochloride |
| SMILES | COc1c(Cl)cc(C(=O)N=C(N)N)cc1N(C)C.Cl.Cl |
| InChI | InChI=1S/C11H15ClN4O2.2ClH/c1-16(2)8-5-6(10(17)15-11(13)14)4-7(12)9(8)18-3;;/h4-5H,1-3H3,(H4,13,14,15,17);2*1H |
| InChIKey | RQYJKRVZALXPKD-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 93.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.64 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|