C14H15N3O3 — CID 15940938
N-(diaminomethylidene)-1,4-dimethoxynaphthalene-2-carboxamide (PubChem CID 15940938) has the molecular formula C14H15N3O3 and a molecular weight of 273.29 g/mol. Its IUPAC name is N-(diaminomethylidene)-1,4-dimethoxynaphthalene-2-carboxamide.
| Compound Name | N-(diaminomethylidene)-1,4-dimethoxynaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 15940938 |
| Molecular Formula | C14H15N3O3 |
| Molecular Weight | 273.29 g/mol |
| Exact Mass | 273.11 |
| IUPAC Name | N-(diaminomethylidene)-1,4-dimethoxynaphthalene-2-carboxamide |
| SMILES | COc1cc(C(=O)N=C(N)N)c(OC)c2ccccc12 |
| InChI | InChI=1S/C14H15N3O3/c1-19-11-7-10(13(18)17-14(15)16)12(20-2)9-6-4-3-5-8(9)11/h3-7H,1-2H3,(H4,15,16,17,18) |
| InChIKey | CVGVEMBAUCGNJO-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 99.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.29 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|