methyl 2,4-dichloro-6-(2-phenylpropanoylamino)benzoate

C17H15Cl2NO3 — CID 68817719

IUPACmethyl 2,4-dichloro-6-(2-phenylpropanoylamino)benzoate
SMILESCOC(=O)c1c(Cl)cc(Cl)cc1NC(=O)C(C)c1ccccc1
InChIInChI=1S/C17H15Cl2NO3/c1-10(11-6-4-3-5-7-11)16(21)20-14-9-12(18)8-13(19)15(14)17(22)23-2/h3-10H,1-2H3,(H,20,21)
InChIKeyLLLPMKANAOMBAG-UHFFFAOYSA-N
MW352.22 g/mol
LogP4.52
Rot. Bonds4

About methyl 2,4-dichloro-6-(2-phenylpropanoylamino)benzoate

methyl 2,4-dichloro-6-(2-phenylpropanoylamino)benzoate (PubChem CID 68817719) has the molecular formula C17H15Cl2NO3 and a molecular weight of 352.22 g/mol. Its IUPAC name is methyl 2,4-dichloro-6-(2-phenylpropanoylamino)benzoate.

Molecular Properties

Compound Namemethyl 2,4-dichloro-6-(2-phenylpropanoylamino)benzoate
PubChem CID68817719
Molecular FormulaC17H15Cl2NO3
Molecular Weight352.22 g/mol
Exact Mass351.04
IUPAC Namemethyl 2,4-dichloro-6-(2-phenylpropanoylamino)benzoate
SMILESCOC(=O)c1c(Cl)cc(Cl)cc1NC(=O)C(C)c1ccccc1
InChIInChI=1S/C17H15Cl2NO3/c1-10(11-6-4-3-5-7-11)16(21)20-14-9-12(18)8-13(19)15(14)17(22)23-2/h3-10H,1-2H3,(H,20,21)
InChIKeyLLLPMKANAOMBAG-UHFFFAOYSA-N
XLogP4.52
TPSA55.40 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms23
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500352.22
LogP ≤ 54.52
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze methyl 2,4-dichloro-6-(2-phenylpropanoylamino)benzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

methyl 2,4-dichloro-6-(2-phenylpropanoylamino)benzoate;2-phenylpropanoic acid
CID 157481591
methyl 4,5-dichloro-2-(2-phenylpropanoylamino)benzoate
CID 68815872
N-(2-chlorophenyl)-2-phenylpropanamide
CID 70678301
methyl 2-(2-phenylpropanoylamino)benzoate
CID 68817246
(2S)-N-(4-chloro-2-fluorophenyl)-2-phenylpropanamide
CID 896234
(2R)-N-(2,3-dichlorophenyl)-2-phenylpropanamide
CID 97038158
methyl 2-[(2-bromoacetyl)amino]-4,6-dichlorobenzoate
CID 22364769
methyl 3-(2-phenylpropanoylamino)benzoate
CID 104916705
(2R)-N-(2,4-dimethoxyphenyl)-2-phenylpropanamide
CID 97038174
methyl 2,6-dichloro-4-[[(1R)-1-phenylethyl]carbamoyl]benzoate
CID 166506945
N-(3-bromo-4-chlorophenyl)-2-phenylpropanamide
CID 114028820
N-(3,5-dichloro-2-hydroxyphenyl)-2-phenylbutanamide
CID 107675571

Frequently Asked Questions

What is the IUPAC name of methyl 2,4-dichloro-6-(2-phenylpropanoylamino)benzoate?
The IUPAC name of methyl 2,4-dichloro-6-(2-phenylpropanoylamino)benzoate (CID 68817719) is methyl 2,4-dichloro-6-(2-phenylpropanoylamino)benzoate.
What is the SMILES notation for methyl 2,4-dichloro-6-(2-phenylpropanoylamino)benzoate?
The canonical SMILES for methyl 2,4-dichloro-6-(2-phenylpropanoylamino)benzoate is COC(=O)c1c(Cl)cc(Cl)cc1NC(=O)C(C)c1ccccc1.
What is the InChIKey of methyl 2,4-dichloro-6-(2-phenylpropanoylamino)benzoate?
The InChIKey is LLLPMKANAOMBAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15Cl2NO3/c1-10(11-6-4-3-5-7-11)16(21)20-14-9-12(18)8-13(19)15(14)17(22)23-2/h3-10H,1-2H3,(H,20,21).
What are the key properties of methyl 2,4-dichloro-6-(2-phenylpropanoylamino)benzoate?
methyl 2,4-dichloro-6-(2-phenylpropanoylamino)benzoate has a molecular weight of 352.22 g/mol, XLogP of 4.52, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2,4-dichloro-6-(2-phenylpropanoylamino)benzoate is sourced from PubChem (CID 68817719), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).