C10H8BrCl2NO3 — CID 22364769
methyl 2-[(2-bromoacetyl)amino]-4,6-dichlorobenzoate (PubChem CID 22364769) has the molecular formula C10H8BrCl2NO3 and a molecular weight of 340.99 g/mol. Its IUPAC name is methyl 2-[(2-bromoacetyl)amino]-4,6-dichlorobenzoate.
| Compound Name | methyl 2-[(2-bromoacetyl)amino]-4,6-dichlorobenzoate |
|---|---|
| PubChem CID | 22364769 |
| Molecular Formula | C10H8BrCl2NO3 |
| Molecular Weight | 340.99 g/mol |
| Exact Mass | 338.91 |
| IUPAC Name | methyl 2-[(2-bromoacetyl)amino]-4,6-dichlorobenzoate |
| SMILES | COC(=O)c1c(Cl)cc(Cl)cc1NC(=O)CBr |
| InChI | InChI=1S/C10H8BrCl2NO3/c1-17-10(16)9-6(13)2-5(12)3-7(9)14-8(15)4-11/h2-3H,4H2,1H3,(H,14,15) |
| InChIKey | SJFWLNJHKFBSMW-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.99 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|