C26H25Cl2NO5 — CID 157481591
methyl 2,4-dichloro-6-(2-phenylpropanoylamino)benzoate;2-phenylpropanoic acid (PubChem CID 157481591) has the molecular formula C26H25Cl2NO5 and a molecular weight of 502.39 g/mol. Its IUPAC name is methyl 2,4-dichloro-6-(2-phenylpropanoylamino)benzoate;2-phenylpropanoic acid.
| Compound Name | methyl 2,4-dichloro-6-(2-phenylpropanoylamino)benzoate;2-phenylpropanoic acid |
|---|---|
| PubChem CID | 157481591 |
| Molecular Formula | C26H25Cl2NO5 |
| Molecular Weight | 502.39 g/mol |
| Exact Mass | 501.11 |
| IUPAC Name | methyl 2,4-dichloro-6-(2-phenylpropanoylamino)benzoate;2-phenylpropanoic acid |
| SMILES | CC(C(=O)O)c1ccccc1.COC(=O)c1c(Cl)cc(Cl)cc1NC(=O)C(C)c1ccccc1 |
| InChI | InChI=1S/C17H15Cl2NO3.C9H10O2/c1-10(11-6-4-3-5-7-11)16(21)20-14-9-12(18)8-13(19)15(14)17(22)23-2;1-7(9(10)11)8-5-3-2-4-6-8/h3-10H,1-2H3,(H,20,21);2-7H,1H3,(H,10,11) |
| InChIKey | BWFKSYUHWHLPPD-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.39 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |