methyl 3-(2,3-dicyanoprop-1-enylamino)thiophene-2-carboxylate

C11H9N3O2S — CID 90146283

IUPACmethyl 3-(2,3-dicyanoprop-1-enylamino)thiophene-2-carboxylate
SMILESCOC(=O)c1sccc1NC=C(C#N)CC#N
InChIInChI=1S/C11H9N3O2S/c1-16-11(15)10-9(3-5-17-10)14-7-8(6-13)2-4-12/h3,5,7,14H,2H2,1H3
InChIKeyRBFLWHDDQPTBJW-UHFFFAOYSA-N
MW247.28 g/mol
LogP2.27
Rot. Bonds4

About methyl 3-(2,3-dicyanoprop-1-enylamino)thiophene-2-carboxylate

methyl 3-(2,3-dicyanoprop-1-enylamino)thiophene-2-carboxylate (PubChem CID 90146283) has the molecular formula C11H9N3O2S and a molecular weight of 247.28 g/mol. Its IUPAC name is methyl 3-(2,3-dicyanoprop-1-enylamino)thiophene-2-carboxylate.

Molecular Properties

Compound Namemethyl 3-(2,3-dicyanoprop-1-enylamino)thiophene-2-carboxylate
PubChem CID90146283
Molecular FormulaC11H9N3O2S
Molecular Weight247.28 g/mol
Exact Mass247.04
IUPAC Namemethyl 3-(2,3-dicyanoprop-1-enylamino)thiophene-2-carboxylate
SMILESCOC(=O)c1sccc1NC=C(C#N)CC#N
InChIInChI=1S/C11H9N3O2S/c1-16-11(15)10-9(3-5-17-10)14-7-8(6-13)2-4-12/h3,5,7,14H,2H2,1H3
InChIKeyRBFLWHDDQPTBJW-UHFFFAOYSA-N
XLogP2.27
TPSA85.91 Ų
H-Bond Donors1
H-Bond Acceptors6
Rotatable Bonds4
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500247.28
LogP ≤ 52.27
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}

Analyze methyl 3-(2,3-dicyanoprop-1-enylamino)thiophene-2-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-(2,3-dicyanoprop-1-enylamino)thiophene-2-carboxylate?
The IUPAC name of methyl 3-(2,3-dicyanoprop-1-enylamino)thiophene-2-carboxylate (CID 90146283) is methyl 3-(2,3-dicyanoprop-1-enylamino)thiophene-2-carboxylate.
What is the SMILES notation for methyl 3-(2,3-dicyanoprop-1-enylamino)thiophene-2-carboxylate?
The canonical SMILES for methyl 3-(2,3-dicyanoprop-1-enylamino)thiophene-2-carboxylate is COC(=O)c1sccc1NC=C(C#N)CC#N.
What is the InChIKey of methyl 3-(2,3-dicyanoprop-1-enylamino)thiophene-2-carboxylate?
The InChIKey is RBFLWHDDQPTBJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9N3O2S/c1-16-11(15)10-9(3-5-17-10)14-7-8(6-13)2-4-12/h3,5,7,14H,2H2,1H3.
What are the key properties of methyl 3-(2,3-dicyanoprop-1-enylamino)thiophene-2-carboxylate?
methyl 3-(2,3-dicyanoprop-1-enylamino)thiophene-2-carboxylate has a molecular weight of 247.28 g/mol, XLogP of 2.27, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-(2,3-dicyanoprop-1-enylamino)thiophene-2-carboxylate is sourced from PubChem (CID 90146283), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).