C11H9N3O2S — CID 90146283
methyl 3-(2,3-dicyanoprop-1-enylamino)thiophene-2-carboxylate (PubChem CID 90146283) has the molecular formula C11H9N3O2S and a molecular weight of 247.28 g/mol. Its IUPAC name is methyl 3-(2,3-dicyanoprop-1-enylamino)thiophene-2-carboxylate.
| Compound Name | methyl 3-(2,3-dicyanoprop-1-enylamino)thiophene-2-carboxylate |
|---|---|
| PubChem CID | 90146283 |
| Molecular Formula | C11H9N3O2S |
| Molecular Weight | 247.28 g/mol |
| Exact Mass | 247.04 |
| IUPAC Name | methyl 3-(2,3-dicyanoprop-1-enylamino)thiophene-2-carboxylate |
| SMILES | COC(=O)c1sccc1NC=C(C#N)CC#N |
| InChI | InChI=1S/C11H9N3O2S/c1-16-11(15)10-9(3-5-17-10)14-7-8(6-13)2-4-12/h3,5,7,14H,2H2,1H3 |
| InChIKey | RBFLWHDDQPTBJW-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 85.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.28 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|