C13H11N3O2 — CID 71231613
methyl 2-[[(E)-2,3-dicyanoprop-1-enyl]amino]benzoate (PubChem CID 71231613) has the molecular formula C13H11N3O2 and a molecular weight of 241.25 g/mol. Its IUPAC name is methyl 2-[[(E)-2,3-dicyanoprop-1-enyl]amino]benzoate.
| Compound Name | methyl 2-[[(E)-2,3-dicyanoprop-1-enyl]amino]benzoate |
|---|---|
| PubChem CID | 71231613 |
| Molecular Formula | C13H11N3O2 |
| Molecular Weight | 241.25 g/mol |
| Exact Mass | 241.09 |
| IUPAC Name | methyl 2-[[(E)-2,3-dicyanoprop-1-enyl]amino]benzoate |
| SMILES | COC(=O)c1ccccc1N/C=C(/C#N)CC#N |
| InChI | InChI=1S/C13H11N3O2/c1-18-13(17)11-4-2-3-5-12(11)16-9-10(8-15)6-7-14/h2-5,9,16H,6H2,1H3/b10-9+ |
| InChIKey | NGQKLLUZCQQGQP-MDZDMXLPSA-N |
| XLogP | 2.21 |
| TPSA | 85.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.25 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|