C17H19N3O3 — CID 108862234
methyl 2-[[(Z)-2-cyano-3-oxo-3-piperidin-1-ylprop-1-enyl]amino]benzoate (PubChem CID 108862234) has the molecular formula C17H19N3O3 and a molecular weight of 313.36 g/mol. Its IUPAC name is methyl 2-[[(Z)-2-cyano-3-oxo-3-piperidin-1-ylprop-1-enyl]amino]benzoate.
| Compound Name | methyl 2-[[(Z)-2-cyano-3-oxo-3-piperidin-1-ylprop-1-enyl]amino]benzoate |
|---|---|
| PubChem CID | 108862234 |
| Molecular Formula | C17H19N3O3 |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.14 |
| IUPAC Name | methyl 2-[[(Z)-2-cyano-3-oxo-3-piperidin-1-ylprop-1-enyl]amino]benzoate |
| SMILES | COC(=O)c1ccccc1N/C=C(/C#N)C(=O)N1CCCCC1 |
| InChI | InChI=1S/C17H19N3O3/c1-23-17(22)14-7-3-4-8-15(14)19-12-13(11-18)16(21)20-9-5-2-6-10-20/h3-4,7-8,12,19H,2,5-6,9-10H2,1H3/b13-12- |
| InChIKey | LFFKSAPDBXKUQQ-SEYXRHQNSA-N |
| XLogP | 2.31 |
| TPSA | 82.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|