C9H9N5O2 — CID 110499452
N-(2-hydroxyphenyl)-2-(2H-tetrazol-5-yl)acetamide (PubChem CID 110499452) has the molecular formula C9H9N5O2 and a molecular weight of 219.20 g/mol. Its IUPAC name is N-(2-hydroxyphenyl)-2-(2H-tetrazol-5-yl)acetamide.
| Compound Name | N-(2-hydroxyphenyl)-2-(2H-tetrazol-5-yl)acetamide |
|---|---|
| PubChem CID | 110499452 |
| Molecular Formula | C9H9N5O2 |
| Molecular Weight | 219.20 g/mol |
| Exact Mass | 219.08 |
| IUPAC Name | N-(2-hydroxyphenyl)-2-(2H-tetrazol-5-yl)acetamide |
| SMILES | O=C(Cc1nn[nH]n1)Nc1ccccc1O |
| InChI | InChI=1S/C9H9N5O2/c15-7-4-2-1-3-6(7)10-9(16)5-8-11-13-14-12-8/h1-4,15H,5H2,(H,10,16)(H,11,12,13,14) |
| InChIKey | QLLHWVINNQMVBY-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 103.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.20 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|