C10H11N5O3S — CID 122146886
methyl 3-[[2-(5-methyltetrazol-1-yl)acetyl]amino]thiophene-2-carboxylate (PubChem CID 122146886) has the molecular formula C10H11N5O3S and a molecular weight of 281.30 g/mol. Its IUPAC name is methyl 3-[[2-(5-methyltetrazol-1-yl)acetyl]amino]thiophene-2-carboxylate.
| Compound Name | methyl 3-[[2-(5-methyltetrazol-1-yl)acetyl]amino]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 122146886 |
| Molecular Formula | C10H11N5O3S |
| Molecular Weight | 281.30 g/mol |
| Exact Mass | 281.06 |
| IUPAC Name | methyl 3-[[2-(5-methyltetrazol-1-yl)acetyl]amino]thiophene-2-carboxylate |
| SMILES | COC(=O)c1sccc1NC(=O)Cn1nnnc1C |
| InChI | InChI=1S/C10H11N5O3S/c1-6-12-13-14-15(6)5-8(16)11-7-3-4-19-9(7)10(17)18-2/h3-4H,5H2,1-2H3,(H,11,16) |
| InChIKey | KYQSIOWHTXHYBG-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 99.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.30 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |