C14H15NOS — CID 7750935
N-(2-ethylphenyl)-2-thiophen-3-ylacetamide (PubChem CID 7750935) has the molecular formula C14H15NOS and a molecular weight of 245.35 g/mol. Its IUPAC name is N-(2-ethylphenyl)-2-thiophen-3-ylacetamide.
| Compound Name | N-(2-ethylphenyl)-2-thiophen-3-ylacetamide |
|---|---|
| PubChem CID | 7750935 |
| Molecular Formula | C14H15NOS |
| Molecular Weight | 245.35 g/mol |
| Exact Mass | 245.09 |
| IUPAC Name | N-(2-ethylphenyl)-2-thiophen-3-ylacetamide |
| SMILES | CCc1ccccc1NC(=O)Cc1ccsc1 |
| InChI | InChI=1S/C14H15NOS/c1-2-12-5-3-4-6-13(12)15-14(16)9-11-7-8-17-10-11/h3-8,10H,2,9H2,1H3,(H,15,16) |
| InChIKey | WJFQERYVVBMLKP-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.35 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |