C21H21NO2S2 — CID 24514543
2-(4-ethoxyphenyl)-N-[2-(thiophen-3-ylmethylsulfanyl)phenyl]acetamide (PubChem CID 24514543) has the molecular formula C21H21NO2S2 and a molecular weight of 383.54 g/mol. Its IUPAC name is 2-(4-ethoxyphenyl)-N-[2-(thiophen-3-ylmethylsulfanyl)phenyl]acetamide.
| Compound Name | 2-(4-ethoxyphenyl)-N-[2-(thiophen-3-ylmethylsulfanyl)phenyl]acetamide |
|---|---|
| PubChem CID | 24514543 |
| Molecular Formula | C21H21NO2S2 |
| Molecular Weight | 383.54 g/mol |
| Exact Mass | 383.10 |
| IUPAC Name | 2-(4-ethoxyphenyl)-N-[2-(thiophen-3-ylmethylsulfanyl)phenyl]acetamide |
| SMILES | CCOc1ccc(CC(=O)Nc2ccccc2SCc2ccsc2)cc1 |
| InChI | InChI=1S/C21H21NO2S2/c1-2-24-18-9-7-16(8-10-18)13-21(23)22-19-5-3-4-6-20(19)26-15-17-11-12-25-14-17/h3-12,14H,2,13,15H2,1H3,(H,22,23) |
| InChIKey | LAEWKQOUOCCZON-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.54 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |