C18H13F2NOS2 — CID 26771142
2,4-difluoro-N-[2-(thiophen-3-ylmethylsulfanyl)phenyl]benzamide (PubChem CID 26771142) has the molecular formula C18H13F2NOS2 and a molecular weight of 361.44 g/mol. Its IUPAC name is 2,4-difluoro-N-[2-(thiophen-3-ylmethylsulfanyl)phenyl]benzamide.
| Compound Name | 2,4-difluoro-N-[2-(thiophen-3-ylmethylsulfanyl)phenyl]benzamide |
|---|---|
| PubChem CID | 26771142 |
| Molecular Formula | C18H13F2NOS2 |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.04 |
| IUPAC Name | 2,4-difluoro-N-[2-(thiophen-3-ylmethylsulfanyl)phenyl]benzamide |
| SMILES | O=C(Nc1ccccc1SCc1ccsc1)c1ccc(F)cc1F |
| InChI | InChI=1S/C18H13F2NOS2/c19-13-5-6-14(15(20)9-13)18(22)21-16-3-1-2-4-17(16)24-11-12-7-8-23-10-12/h1-10H,11H2,(H,21,22) |
| InChIKey | XKUFPOXFGQGQIQ-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |