C24H23FN2O2S2 — CID 24514557
1-(4-fluorobenzoyl)-N-[2-(thiophen-3-ylmethylsulfanyl)phenyl]piperidine-4-carboxamide (PubChem CID 24514557) has the molecular formula C24H23FN2O2S2 and a molecular weight of 454.59 g/mol. Its IUPAC name is 1-(4-fluorobenzoyl)-N-[2-(thiophen-3-ylmethylsulfanyl)phenyl]piperidine-4-carboxamide.
| Compound Name | 1-(4-fluorobenzoyl)-N-[2-(thiophen-3-ylmethylsulfanyl)phenyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 24514557 |
| Molecular Formula | C24H23FN2O2S2 |
| Molecular Weight | 454.59 g/mol |
| Exact Mass | 454.12 |
| IUPAC Name | 1-(4-fluorobenzoyl)-N-[2-(thiophen-3-ylmethylsulfanyl)phenyl]piperidine-4-carboxamide |
| SMILES | O=C(Nc1ccccc1SCc1ccsc1)C1CCN(C(=O)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C24H23FN2O2S2/c25-20-7-5-19(6-8-20)24(29)27-12-9-18(10-13-27)23(28)26-21-3-1-2-4-22(21)31-16-17-11-14-30-15-17/h1-8,11,14-15,18H,9-10,12-13,16H2,(H,26,28) |
| InChIKey | YJGGRHURYHSPHL-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.59 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |