C20H16N2O2S2 — CID 18275752
2-(4-cyanophenoxy)-N-[2-(thiophen-3-ylmethylsulfanyl)phenyl]acetamide (PubChem CID 18275752) has the molecular formula C20H16N2O2S2 and a molecular weight of 380.49 g/mol. Its IUPAC name is 2-(4-cyanophenoxy)-N-[2-(thiophen-3-ylmethylsulfanyl)phenyl]acetamide.
| Compound Name | 2-(4-cyanophenoxy)-N-[2-(thiophen-3-ylmethylsulfanyl)phenyl]acetamide |
|---|---|
| PubChem CID | 18275752 |
| Molecular Formula | C20H16N2O2S2 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.07 |
| IUPAC Name | 2-(4-cyanophenoxy)-N-[2-(thiophen-3-ylmethylsulfanyl)phenyl]acetamide |
| SMILES | N#Cc1ccc(OCC(=O)Nc2ccccc2SCc2ccsc2)cc1 |
| InChI | InChI=1S/C20H16N2O2S2/c21-11-15-5-7-17(8-6-15)24-12-20(23)22-18-3-1-2-4-19(18)26-14-16-9-10-25-13-16/h1-10,13H,12,14H2,(H,22,23) |
| InChIKey | ISYYQNRDMNHRNK-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |