C18H14FNOS2 — CID 26771125
4-fluoro-N-[2-(thiophen-3-ylmethylsulfanyl)phenyl]benzamide (PubChem CID 26771125) has the molecular formula C18H14FNOS2 and a molecular weight of 343.45 g/mol. Its IUPAC name is 4-fluoro-N-[2-(thiophen-3-ylmethylsulfanyl)phenyl]benzamide.
| Compound Name | 4-fluoro-N-[2-(thiophen-3-ylmethylsulfanyl)phenyl]benzamide |
|---|---|
| PubChem CID | 26771125 |
| Molecular Formula | C18H14FNOS2 |
| Molecular Weight | 343.45 g/mol |
| Exact Mass | 343.05 |
| IUPAC Name | 4-fluoro-N-[2-(thiophen-3-ylmethylsulfanyl)phenyl]benzamide |
| SMILES | O=C(Nc1ccccc1SCc1ccsc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C18H14FNOS2/c19-15-7-5-14(6-8-15)18(21)20-16-3-1-2-4-17(16)23-12-13-9-10-22-11-13/h1-11H,12H2,(H,20,21) |
| InChIKey | OZGIKHMQNHKQDT-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.45 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |